C15H21BrFNO — CID 116723316
3-(2-bromo-4-fluorophenyl)-1-cyclopropyl-1-ethoxy-N-methylpropan-2-amine (PubChem CID 116723316) has the molecular formula C15H21BrFNO and a molecular weight of 330.24 g/mol. Its IUPAC name is 3-(2-bromo-4-fluorophenyl)-1-cyclopropyl-1-ethoxy-N-methylpropan-2-amine.
| Compound Name | 3-(2-bromo-4-fluorophenyl)-1-cyclopropyl-1-ethoxy-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 116723316 |
| Molecular Formula | C15H21BrFNO |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 3-(2-bromo-4-fluorophenyl)-1-cyclopropyl-1-ethoxy-N-methylpropan-2-amine |
| SMILES | CCOC(C1CC1)C(Cc1ccc(F)cc1Br)NC |
| InChI | InChI=1S/C15H21BrFNO/c1-3-19-15(10-4-5-10)14(18-2)8-11-6-7-12(17)9-13(11)16/h6-7,9-10,14-15,18H,3-5,8H2,1-2H3 |
| InChIKey | NTUIQOKEAVTTBS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |