C17H24N2O — CID 116724332
3-methoxy-4,4-dimethyl-1-quinolin-2-ylpentan-2-amine (PubChem CID 116724332) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-methoxy-4,4-dimethyl-1-quinolin-2-ylpentan-2-amine.
| Compound Name | 3-methoxy-4,4-dimethyl-1-quinolin-2-ylpentan-2-amine |
|---|---|
| PubChem CID | 116724332 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-methoxy-4,4-dimethyl-1-quinolin-2-ylpentan-2-amine |
| SMILES | COC(C(N)Cc1ccc2ccccc2n1)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O/c1-17(2,3)16(20-4)14(18)11-13-10-9-12-7-5-6-8-15(12)19-13/h5-10,14,16H,11,18H2,1-4H3 |
| InChIKey | ABTKSRYUNAHZIE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |