C14H15F3N2O — CID 103215601
1-quinolin-2-yl-3-(2,2,2-trifluoroethoxy)propan-2-amine (PubChem CID 103215601) has the molecular formula C14H15F3N2O and a molecular weight of 284.28 g/mol. Its IUPAC name is 1-quinolin-2-yl-3-(2,2,2-trifluoroethoxy)propan-2-amine.
| Compound Name | 1-quinolin-2-yl-3-(2,2,2-trifluoroethoxy)propan-2-amine |
|---|---|
| PubChem CID | 103215601 |
| Molecular Formula | C14H15F3N2O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-quinolin-2-yl-3-(2,2,2-trifluoroethoxy)propan-2-amine |
| SMILES | NC(COCC(F)(F)F)Cc1ccc2ccccc2n1 |
| InChI | InChI=1S/C14H15F3N2O/c15-14(16,17)9-20-8-11(18)7-12-6-5-10-3-1-2-4-13(10)19-12/h1-6,11H,7-9,18H2 |
| InChIKey | IDVZTXFEBSBQCD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |