C17H24N2O — CID 116725171
2-ethoxy-1-isoquinolin-5-yl-3,3-dimethylbutan-1-amine (PubChem CID 116725171) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-ethoxy-1-isoquinolin-5-yl-3,3-dimethylbutan-1-amine.
| Compound Name | 2-ethoxy-1-isoquinolin-5-yl-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 116725171 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 2-ethoxy-1-isoquinolin-5-yl-3,3-dimethylbutan-1-amine |
| SMILES | CCOC(C(N)c1cccc2cnccc12)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O/c1-5-20-16(17(2,3)4)15(18)14-8-6-7-12-11-19-10-9-13(12)14/h6-11,15-16H,5,18H2,1-4H3 |
| InChIKey | DFTWPJGQOVVVEY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |