C15H23Cl2NO — CID 116727046
1-(2,5-dichlorophenyl)-2-ethoxy-2-methyl-N-propylpropan-1-amine (PubChem CID 116727046) has the molecular formula C15H23Cl2NO and a molecular weight of 304.26 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-2-ethoxy-2-methyl-N-propylpropan-1-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-2-ethoxy-2-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 116727046 |
| Molecular Formula | C15H23Cl2NO |
| Molecular Weight | 304.26 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-2-ethoxy-2-methyl-N-propylpropan-1-amine |
| SMILES | CCCNC(c1cc(Cl)ccc1Cl)C(C)(C)OCC |
| InChI | InChI=1S/C15H23Cl2NO/c1-5-9-18-14(15(3,4)19-6-2)12-10-11(16)7-8-13(12)17/h7-8,10,14,18H,5-6,9H2,1-4H3 |
| InChIKey | SXHGPQQUAWSZJE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.26 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |