About 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one
2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 116727487) has the molecular formula C12H17NO2S
and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
Molecular Properties
| Compound Name | 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| PubChem CID | 116727487 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | CCCC(OC)c1nc2c(s1)C(=O)CCC2 |
| InChI | InChI=1S/C12H17NO2S/c1-3-5-10(15-2)12-13-8-6-4-7-9(14)11(8)16-12/h10H,3-7H2,1-2H3 |
| InChIKey | RFTSDPQDZXJCKR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The IUPAC name of 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (CID 116727487) is 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
What is the SMILES notation for 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The canonical SMILES for 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one is CCCC(OC)c1nc2c(s1)C(=O)CCC2.
What is the InChIKey of 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The InChIKey is RFTSDPQDZXJCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2S/c1-3-5-10(15-2)12-13-8-6-4-7-9(14)11(8)16-12/h10H,3-7H2,1-2H3.
What are the key properties of 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one?
2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one has a molecular weight of 239.34 g/mol, XLogP of 3.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one is sourced from PubChem (CID 116727487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).