C12H17NO2S — CID 116727487
2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 116727487) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
| Compound Name | 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 116727487 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 2-(1-methoxybutyl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | CCCC(OC)c1nc2c(s1)C(=O)CCC2 |
| InChI | InChI=1S/C12H17NO2S/c1-3-5-10(15-2)12-13-8-6-4-7-9(14)11(8)16-12/h10H,3-7H2,1-2H3 |
| InChIKey | RFTSDPQDZXJCKR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |