C9H11NOS — CID 62079122
2-ethyl-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 62079122) has the molecular formula C9H11NOS and a molecular weight of 181.26 g/mol. Its IUPAC name is 2-ethyl-5,6-dihydro-4H-1,3-benzothiazol-7-one.
| Compound Name | 2-ethyl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 62079122 |
| Molecular Formula | C9H11NOS |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2-ethyl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | CCc1nc2c(s1)C(=O)CCC2 |
| InChI | InChI=1S/C9H11NOS/c1-2-8-10-6-4-3-5-7(11)9(6)12-8/h2-5H2,1H3 |
| InChIKey | PGYPJBVYLUZTEI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |