About 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole
2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (PubChem CID 58541380) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
Analyze 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The IUPAC name of 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (CID 58541380) is 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
What is the SMILES notation for 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The canonical SMILES for 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is CCc1nc2c(s1)CCC2.
What is the InChIKey of 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The InChIKey is BEDFYAWIFLERQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-2-8-9-6-4-3-5-7(6)10-8/h2-5H2,1H3.
What are the key properties of 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole has a molecular weight of 153.25 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is sourced from PubChem (CID 58541380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).