About 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine
4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine (PubChem CID 3469612) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine.
Analyze 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine?
The IUPAC name of 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine (CID 3469612) is 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine.
What is the SMILES notation for 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine?
The canonical SMILES for 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine is NCc1nc2c(s1)CCCC2.
What is the InChIKey of 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine?
The InChIKey is MVXOUEFCXDHEAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c9-5-8-10-6-3-1-2-4-7(6)11-8/h1-5,9H2.
What are the key properties of 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine?
4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine has a molecular weight of 168.26 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-1,3-benzothiazol-2-ylmethanamine is sourced from PubChem (CID 3469612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).