About 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole
2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (PubChem CID 130511936) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
Analyze 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The IUPAC name of 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (CID 130511936) is 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
What is the SMILES notation for 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The canonical SMILES for 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is CCCc1nc2c(s1)CCC2.
What is the InChIKey of 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The InChIKey is OKTIELLCTNQEGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c1-2-4-9-10-7-5-3-6-8(7)11-9/h2-6H2,1H3.
What are the key properties of 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole has a molecular weight of 167.28 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is sourced from PubChem (CID 130511936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).