C12H21N3O — CID 116729178
2-(1-ethoxypropyl)-6-ethyl-5-methylpyrimidin-4-amine (PubChem CID 116729178) has the molecular formula C12H21N3O and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(1-ethoxypropyl)-6-ethyl-5-methylpyrimidin-4-amine.
| Compound Name | 2-(1-ethoxypropyl)-6-ethyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116729178 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(1-ethoxypropyl)-6-ethyl-5-methylpyrimidin-4-amine |
| SMILES | CCOC(CC)c1nc(N)c(C)c(CC)n1 |
| InChI | InChI=1S/C12H21N3O/c1-5-9-8(4)11(13)15-12(14-9)10(6-2)16-7-3/h10H,5-7H2,1-4H3,(H2,13,14,15) |
| InChIKey | VXAPKJQQOAUUPQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |