C10H17N3O2S — CID 116633207
6-ethyl-5-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine (PubChem CID 116633207) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 6-ethyl-5-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine.
| Compound Name | 6-ethyl-5-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116633207 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 6-ethyl-5-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine |
| SMILES | CCc1nc(C(C)S(C)(=O)=O)nc(N)c1C |
| InChI | InChI=1S/C10H17N3O2S/c1-5-8-6(2)9(11)13-10(12-8)7(3)16(4,14)15/h7H,5H2,1-4H3,(H2,11,12,13) |
| InChIKey | BNOSTJYSHXRJTD-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |