C12H20IN3O2S — CID 116633231
N-ethyl-5-iodo-2-(1-methylsulfonylethyl)-6-propylpyrimidin-4-amine (PubChem CID 116633231) has the molecular formula C12H20IN3O2S and a molecular weight of 397.28 g/mol. Its IUPAC name is N-ethyl-5-iodo-2-(1-methylsulfonylethyl)-6-propylpyrimidin-4-amine.
| Compound Name | N-ethyl-5-iodo-2-(1-methylsulfonylethyl)-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116633231 |
| Molecular Formula | C12H20IN3O2S |
| Molecular Weight | 397.28 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-ethyl-5-iodo-2-(1-methylsulfonylethyl)-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(C(C)S(C)(=O)=O)nc(NCC)c1I |
| InChI | InChI=1S/C12H20IN3O2S/c1-5-7-9-10(13)12(14-6-2)16-11(15-9)8(3)19(4,17)18/h8H,5-7H2,1-4H3,(H,14,15,16) |
| InChIKey | NGYPGRQGRDFDIB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|