C13H22BrN3O2S — CID 116633228
5-bromo-2-(1-methylsulfonylethyl)-N,6-dipropylpyrimidin-4-amine (PubChem CID 116633228) has the molecular formula C13H22BrN3O2S and a molecular weight of 364.31 g/mol. Its IUPAC name is 5-bromo-2-(1-methylsulfonylethyl)-N,6-dipropylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(1-methylsulfonylethyl)-N,6-dipropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116633228 |
| Molecular Formula | C13H22BrN3O2S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 5-bromo-2-(1-methylsulfonylethyl)-N,6-dipropylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C(C)S(C)(=O)=O)nc(CCC)c1Br |
| InChI | InChI=1S/C13H22BrN3O2S/c1-5-7-10-11(14)13(15-8-6-2)17-12(16-10)9(3)20(4,18)19/h9H,5-8H2,1-4H3,(H,15,16,17) |
| InChIKey | GYOATYSJUOZRED-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |