C14H24IN3O2S — CID 116633286
5-iodo-6-(2-methylpropyl)-2-(1-methylsulfonylethyl)-N-propylpyrimidin-4-amine (PubChem CID 116633286) has the molecular formula C14H24IN3O2S and a molecular weight of 425.34 g/mol. Its IUPAC name is 5-iodo-6-(2-methylpropyl)-2-(1-methylsulfonylethyl)-N-propylpyrimidin-4-amine.
| Compound Name | 5-iodo-6-(2-methylpropyl)-2-(1-methylsulfonylethyl)-N-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116633286 |
| Molecular Formula | C14H24IN3O2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 5-iodo-6-(2-methylpropyl)-2-(1-methylsulfonylethyl)-N-propylpyrimidin-4-amine |
| SMILES | CCCNc1nc(C(C)S(C)(=O)=O)nc(CC(C)C)c1I |
| InChI | InChI=1S/C14H24IN3O2S/c1-6-7-16-14-12(15)11(8-9(2)3)17-13(18-14)10(4)21(5,19)20/h9-10H,6-8H2,1-5H3,(H,16,17,18) |
| InChIKey | MITYGQMNPGBMSG-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|