C15H26IN3O — CID 116729448
2-(1-ethoxy-2-methylpropyl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine (PubChem CID 116729448) has the molecular formula C15H26IN3O and a molecular weight of 391.30 g/mol. Its IUPAC name is 2-(1-ethoxy-2-methylpropyl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine.
| Compound Name | 2-(1-ethoxy-2-methylpropyl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 116729448 |
| Molecular Formula | C15H26IN3O |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-(1-ethoxy-2-methylpropyl)-N-ethyl-5-iodo-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(C(OCC)C(C)C)nc(NCC)c1I |
| InChI | InChI=1S/C15H26IN3O/c1-6-9-11-12(16)14(17-7-2)19-15(18-11)13(10(4)5)20-8-3/h10,13H,6-9H2,1-5H3,(H,17,18,19) |
| InChIKey | DCNLKWDEECOWDT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|