About 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine
6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine (PubChem CID 63560963) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine |
| PubChem CID | 63560963 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine |
| SMILES | CCc1nc(C(C)C)nc(NC)c1C |
| InChI | InChI=1S/C11H19N3/c1-6-9-8(4)11(12-5)14-10(13-9)7(2)3/h7H,6H2,1-5H3,(H,12,13,14) |
| InChIKey | JIWBVONRNJNSPY-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine?
The IUPAC name of 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine (CID 63560963) is 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine.
What is the SMILES notation for 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine?
The canonical SMILES for 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine is CCc1nc(C(C)C)nc(NC)c1C.
What is the InChIKey of 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine?
The InChIKey is JIWBVONRNJNSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3/c1-6-9-8(4)11(12-5)14-10(13-9)7(2)3/h7H,6H2,1-5H3,(H,12,13,14).
What are the key properties of 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine?
6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine has a molecular weight of 193.29 g/mol, XLogP of 2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-N,5-dimethyl-2-propan-2-ylpyrimidin-4-amine is sourced from PubChem (CID 63560963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).