C8H12BrN3O2S — CID 116633219
5-bromo-6-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine (PubChem CID 116633219) has the molecular formula C8H12BrN3O2S and a molecular weight of 294.17 g/mol. Its IUPAC name is 5-bromo-6-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine.
| Compound Name | 5-bromo-6-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 116633219 |
| Molecular Formula | C8H12BrN3O2S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5-bromo-6-methyl-2-(1-methylsulfonylethyl)pyrimidin-4-amine |
| SMILES | Cc1nc(C(C)S(C)(=O)=O)nc(N)c1Br |
| InChI | InChI=1S/C8H12BrN3O2S/c1-4-6(9)7(10)12-8(11-4)5(2)15(3,13)14/h5H,1-3H3,(H2,10,11,12) |
| InChIKey | CRCSRJCCXKCNJW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |