C7H7Cl2FN2O2S — CID 116633050
4,6-dichloro-5-fluoro-2-(1-methylsulfonylethyl)pyrimidine (PubChem CID 116633050) has the molecular formula C7H7Cl2FN2O2S and a molecular weight of 273.12 g/mol. Its IUPAC name is 4,6-dichloro-5-fluoro-2-(1-methylsulfonylethyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-fluoro-2-(1-methylsulfonylethyl)pyrimidine |
|---|---|
| PubChem CID | 116633050 |
| Molecular Formula | C7H7Cl2FN2O2S |
| Molecular Weight | 273.12 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 4,6-dichloro-5-fluoro-2-(1-methylsulfonylethyl)pyrimidine |
| SMILES | CC(c1nc(Cl)c(F)c(Cl)n1)S(C)(=O)=O |
| InChI | InChI=1S/C7H7Cl2FN2O2S/c1-3(15(2,13)14)7-11-5(8)4(10)6(9)12-7/h3H,1-2H3 |
| InChIKey | AKDNYUHKVQVFGH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.12 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |