About ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate
ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate (PubChem CID 11673071) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate.
Analyze ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate?
The IUPAC name of ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate (CID 11673071) is ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate.
What is the SMILES notation for ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate?
The canonical SMILES for ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate is CCOC(=O)CC[C@H](C)[C@H]1COC(C)(C)O1.
What is the InChIKey of ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate?
The InChIKey is KHTPCRSISAOUPL-VHSXEESVSA-N. The full InChI is InChI=1S/C12H22O4/c1-5-14-11(13)7-6-9(2)10-8-15-12(3,4)16-10/h9-10H,5-8H2,1-4H3/t9-,10+/m0/s1.
What are the key properties of ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate?
ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate has a molecular weight of 230.30 g/mol, XLogP of 2.12, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (4S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pentanoate is sourced from PubChem (CID 11673071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).