About 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid
2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid (PubChem CID 116734994) has the molecular formula C11H16N6O2
and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid |
| PubChem CID | 116734994 |
| Molecular Formula | C11H16N6O2 |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid |
| SMILES | Cc1cc(Cn2cc(CC(N)C(=O)O)nn2)n(C)n1 |
| InChI | InChI=1S/C11H16N6O2/c1-7-3-9(16(2)14-7)6-17-5-8(13-15-17)4-10(12)11(18)19/h3,5,10H,4,6,12H2,1-2H3,(H,18,19) |
| InChIKey | GFFBUBGQQKEPNX-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid?
The IUPAC name of 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid (CID 116734994) is 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid.
What is the SMILES notation for 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid?
The canonical SMILES for 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid is Cc1cc(Cn2cc(CC(N)C(=O)O)nn2)n(C)n1.
What is the InChIKey of 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid?
The InChIKey is GFFBUBGQQKEPNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O2/c1-7-3-9(16(2)14-7)6-17-5-8(13-15-17)4-10(12)11(18)19/h3,5,10H,4,6,12H2,1-2H3,(H,18,19).
What are the key properties of 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid?
2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid has a molecular weight of 264.29 g/mol, XLogP of -0.68, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[1-[(2,5-dimethylpyrazol-3-yl)methyl]triazol-4-yl]propanoic acid is sourced from PubChem (CID 116734994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).