C15H28N4O2 — CID 116735123
2-amino-3-(1-decyltriazol-4-yl)propanoic acid (PubChem CID 116735123) has the molecular formula C15H28N4O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 2-amino-3-(1-decyltriazol-4-yl)propanoic acid.
| Compound Name | 2-amino-3-(1-decyltriazol-4-yl)propanoic acid |
|---|---|
| PubChem CID | 116735123 |
| Molecular Formula | C15H28N4O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | 2-amino-3-(1-decyltriazol-4-yl)propanoic acid |
| SMILES | CCCCCCCCCCn1cc(CC(N)C(=O)O)nn1 |
| InChI | InChI=1S/C15H28N4O2/c1-2-3-4-5-6-7-8-9-10-19-12-13(17-18-19)11-14(16)15(20)21/h12,14H,2-11,16H2,1H3,(H,20,21) |
| InChIKey | PPPGKYRBLRFWCG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|