C10H19N5O2 — CID 114526544
2-amino-3-[1-[3-(dimethylamino)propyl]triazol-4-yl]propanoic acid (PubChem CID 114526544) has the molecular formula C10H19N5O2 and a molecular weight of 241.29 g/mol. Its IUPAC name is 2-amino-3-[1-[3-(dimethylamino)propyl]triazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[1-[3-(dimethylamino)propyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 114526544 |
| Molecular Formula | C10H19N5O2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-amino-3-[1-[3-(dimethylamino)propyl]triazol-4-yl]propanoic acid |
| SMILES | CN(C)CCCn1cc(CC(N)C(=O)O)nn1 |
| InChI | InChI=1S/C10H19N5O2/c1-14(2)4-3-5-15-7-8(12-13-15)6-9(11)10(16)17/h7,9H,3-6,11H2,1-2H3,(H,16,17) |
| InChIKey | CZHUUICFUVANQD-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |