C12H21N5O2 — CID 116735211
2-amino-3-[1-(3-pyrrolidin-1-ylpropyl)triazol-4-yl]propanoic acid (PubChem CID 116735211) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-amino-3-[1-(3-pyrrolidin-1-ylpropyl)triazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[1-(3-pyrrolidin-1-ylpropyl)triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 116735211 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-amino-3-[1-(3-pyrrolidin-1-ylpropyl)triazol-4-yl]propanoic acid |
| SMILES | NC(Cc1cn(CCCN2CCCC2)nn1)C(=O)O |
| InChI | InChI=1S/C12H21N5O2/c13-11(12(18)19)8-10-9-17(15-14-10)7-3-6-16-4-1-2-5-16/h9,11H,1-8,13H2,(H,18,19) |
| InChIKey | NFHXBTVNHWFVLO-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |