C12H20N6O3 — CID 116735191
2-amino-3-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]propanoic acid (PubChem CID 116735191) has the molecular formula C12H20N6O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-amino-3-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]propanoic acid.
| Compound Name | 2-amino-3-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]propanoic acid |
|---|---|
| PubChem CID | 116735191 |
| Molecular Formula | C12H20N6O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-amino-3-[1-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]triazol-4-yl]propanoic acid |
| SMILES | CN1CCN(C(=O)Cn2cc(CC(N)C(=O)O)nn2)CC1 |
| InChI | InChI=1S/C12H20N6O3/c1-16-2-4-17(5-3-16)11(19)8-18-7-9(14-15-18)6-10(13)12(20)21/h7,10H,2-6,8,13H2,1H3,(H,20,21) |
| InChIKey | OQWAZKGESBTEHF-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |