C13H10BrFN2OS — CID 116737561
5-bromo-6-fluoro-3-[2-(furan-2-yl)ethyl]-1H-benzimidazole-2-thione (PubChem CID 116737561) has the molecular formula C13H10BrFN2OS and a molecular weight of 341.21 g/mol. Its IUPAC name is 5-bromo-6-fluoro-3-[2-(furan-2-yl)ethyl]-1H-benzimidazole-2-thione.
| Compound Name | 5-bromo-6-fluoro-3-[2-(furan-2-yl)ethyl]-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 116737561 |
| Molecular Formula | C13H10BrFN2OS |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 5-bromo-6-fluoro-3-[2-(furan-2-yl)ethyl]-1H-benzimidazole-2-thione |
| SMILES | Fc1cc2[nH]c(=S)n(CCc3ccco3)c2cc1Br |
| InChI | InChI=1S/C13H10BrFN2OS/c14-9-6-12-11(7-10(9)15)16-13(19)17(12)4-3-8-2-1-5-18-8/h1-2,5-7H,3-4H2,(H,16,19) |
| InChIKey | POKUHVZOKAQTLG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 33.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|