C14H16BrFN2S — CID 116737806
5-bromo-3-(2,2-dimethylcyclopentyl)-6-fluoro-1H-benzimidazole-2-thione (PubChem CID 116737806) has the molecular formula C14H16BrFN2S and a molecular weight of 343.27 g/mol. Its IUPAC name is 5-bromo-3-(2,2-dimethylcyclopentyl)-6-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 5-bromo-3-(2,2-dimethylcyclopentyl)-6-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 116737806 |
| Molecular Formula | C14H16BrFN2S |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 5-bromo-3-(2,2-dimethylcyclopentyl)-6-fluoro-1H-benzimidazole-2-thione |
| SMILES | CC1(C)CCCC1n1c(=S)[nH]c2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C14H16BrFN2S/c1-14(2)5-3-4-12(14)18-11-6-8(15)9(16)7-10(11)17-13(18)19/h6-7,12H,3-5H2,1-2H3,(H,17,19) |
| InChIKey | DCUVGZQFXFPKDC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|