C15H18BrFN2S — CID 66087455
6-bromo-3-(3,4-dimethylcyclohexyl)-5-fluoro-1H-benzimidazole-2-thione (PubChem CID 66087455) has the molecular formula C15H18BrFN2S and a molecular weight of 357.29 g/mol. Its IUPAC name is 6-bromo-3-(3,4-dimethylcyclohexyl)-5-fluoro-1H-benzimidazole-2-thione.
| Compound Name | 6-bromo-3-(3,4-dimethylcyclohexyl)-5-fluoro-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66087455 |
| Molecular Formula | C15H18BrFN2S |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 6-bromo-3-(3,4-dimethylcyclohexyl)-5-fluoro-1H-benzimidazole-2-thione |
| SMILES | CC1CCC(n2c(=S)[nH]c3cc(Br)c(F)cc32)CC1C |
| InChI | InChI=1S/C15H18BrFN2S/c1-8-3-4-10(5-9(8)2)19-14-7-12(17)11(16)6-13(14)18-15(19)20/h6-10H,3-5H2,1-2H3,(H,18,20) |
| InChIKey | NELALOOEOCVZGO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|