C14H18BrN3S — CID 79306919
6-bromo-3-(3,4-dimethylcyclohexyl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 79306919) has the molecular formula C14H18BrN3S and a molecular weight of 340.29 g/mol. Its IUPAC name is 6-bromo-3-(3,4-dimethylcyclohexyl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-bromo-3-(3,4-dimethylcyclohexyl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 79306919 |
| Molecular Formula | C14H18BrN3S |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 6-bromo-3-(3,4-dimethylcyclohexyl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | CC1CCC(n2c(=S)[nH]c3cc(Br)cnc32)CC1C |
| InChI | InChI=1S/C14H18BrN3S/c1-8-3-4-11(5-9(8)2)18-13-12(17-14(18)19)6-10(15)7-16-13/h6-9,11H,3-5H2,1-2H3,(H,17,19) |
| InChIKey | BKUWVQSKULUYCV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|