C12H16BrFN4 — CID 116738307
6-bromo-1-[2-[ethyl(methyl)amino]ethyl]-5-fluorobenzimidazol-2-amine (PubChem CID 116738307) has the molecular formula C12H16BrFN4 and a molecular weight of 315.19 g/mol. Its IUPAC name is 6-bromo-1-[2-[ethyl(methyl)amino]ethyl]-5-fluorobenzimidazol-2-amine.
| Compound Name | 6-bromo-1-[2-[ethyl(methyl)amino]ethyl]-5-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 116738307 |
| Molecular Formula | C12H16BrFN4 |
| Molecular Weight | 315.19 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 6-bromo-1-[2-[ethyl(methyl)amino]ethyl]-5-fluorobenzimidazol-2-amine |
| SMILES | CCN(C)CCn1c(N)nc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C12H16BrFN4/c1-3-17(2)4-5-18-11-6-8(13)9(14)7-10(11)16-12(18)15/h6-7H,3-5H2,1-2H3,(H2,15,16) |
| InChIKey | BUVZVOIKUFLFFU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |