C12H15BrFN3 — CID 116738073
6-bromo-5-fluoro-1-(2-methylbutan-2-yl)benzimidazol-2-amine (PubChem CID 116738073) has the molecular formula C12H15BrFN3 and a molecular weight of 300.18 g/mol. Its IUPAC name is 6-bromo-5-fluoro-1-(2-methylbutan-2-yl)benzimidazol-2-amine.
| Compound Name | 6-bromo-5-fluoro-1-(2-methylbutan-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 116738073 |
| Molecular Formula | C12H15BrFN3 |
| Molecular Weight | 300.18 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 6-bromo-5-fluoro-1-(2-methylbutan-2-yl)benzimidazol-2-amine |
| SMILES | CCC(C)(C)n1c(N)nc2cc(F)c(Br)cc21 |
| InChI | InChI=1S/C12H15BrFN3/c1-4-12(2,3)17-10-5-7(13)8(14)6-9(10)16-11(17)15/h5-6H,4H2,1-3H3,(H2,15,16) |
| InChIKey | LCFUXLDCFQMPGT-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |