C18H14N2OS — CID 11673933
4-[2-[5-(4-methoxyphenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole (PubChem CID 11673933) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 4-[2-[5-(4-methoxyphenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole.
| Compound Name | 4-[2-[5-(4-methoxyphenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 11673933 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-[2-[5-(4-methoxyphenyl)-3-pyridinyl]ethynyl]-2-methyl-1,3-thiazole |
| SMILES | COc1ccc(-c2cncc(C#Cc3csc(C)n3)c2)cc1 |
| InChI | InChI=1S/C18H14N2OS/c1-13-20-17(12-22-13)6-3-14-9-16(11-19-10-14)15-4-7-18(21-2)8-5-15/h4-5,7-12H,1-2H3 |
| InChIKey | HRXXCCBTQISFLQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|