C14H16BrFN2O — CID 116739803
6-bromo-3-cyclohexyl-7-fluoro-3,4-dihydro-1H-quinoxalin-2-one (PubChem CID 116739803) has the molecular formula C14H16BrFN2O and a molecular weight of 327.20 g/mol. Its IUPAC name is 6-bromo-3-cyclohexyl-7-fluoro-3,4-dihydro-1H-quinoxalin-2-one.
| Compound Name | 6-bromo-3-cyclohexyl-7-fluoro-3,4-dihydro-1H-quinoxalin-2-one |
|---|---|
| PubChem CID | 116739803 |
| Molecular Formula | C14H16BrFN2O |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 6-bromo-3-cyclohexyl-7-fluoro-3,4-dihydro-1H-quinoxalin-2-one |
| SMILES | O=C1Nc2cc(F)c(Br)cc2NC1C1CCCCC1 |
| InChI | InChI=1S/C14H16BrFN2O/c15-9-6-11-12(7-10(9)16)18-14(19)13(17-11)8-4-2-1-3-5-8/h6-8,13,17H,1-5H2,(H,18,19) |
| InChIKey | HMNCFAWZIOBLCC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |