C13H23N3O3 — CID 116742227
4-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]butan-2-amine (PubChem CID 116742227) has the molecular formula C13H23N3O3 and a molecular weight of 269.34 g/mol. Its IUPAC name is 4-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]butan-2-amine.
| Compound Name | 4-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]butan-2-amine |
|---|---|
| PubChem CID | 116742227 |
| Molecular Formula | C13H23N3O3 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.17 |
| IUPAC Name | 4-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]butan-2-amine |
| SMILES | CCOC1(c2noc(CCC(C)N)n2)CCOCC1 |
| InChI | InChI=1S/C13H23N3O3/c1-3-18-13(6-8-17-9-7-13)12-15-11(19-16-12)5-4-10(2)14/h10H,3-9,14H2,1-2H3 |
| InChIKey | IKRNHVVPCBKRNS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |