C14H24N2O4 — CID 116780755
3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-ol (PubChem CID 116780755) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-ol.
| Compound Name | 3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-ol |
|---|---|
| PubChem CID | 116780755 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 3-[3-(4-ethoxyoxan-4-yl)-1,2,4-oxadiazol-5-yl]pentan-2-ol |
| SMILES | CCOC1(c2noc(C(CC)C(C)O)n2)CCOCC1 |
| InChI | InChI=1S/C14H24N2O4/c1-4-11(10(3)17)12-15-13(16-20-12)14(19-5-2)6-8-18-9-7-14/h10-11,17H,4-9H2,1-3H3 |
| InChIKey | YAPGCPLCSYNPLJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 77.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |