C13H21NO3S — CID 116744684
4-(dimethoxymethyl)-2-(1-methoxycyclohexyl)-1,3-thiazole (PubChem CID 116744684) has the molecular formula C13H21NO3S and a molecular weight of 271.38 g/mol. Its IUPAC name is 4-(dimethoxymethyl)-2-(1-methoxycyclohexyl)-1,3-thiazole.
| Compound Name | 4-(dimethoxymethyl)-2-(1-methoxycyclohexyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116744684 |
| Molecular Formula | C13H21NO3S |
| Molecular Weight | 271.38 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4-(dimethoxymethyl)-2-(1-methoxycyclohexyl)-1,3-thiazole |
| SMILES | COC(OC)c1csc(C2(OC)CCCCC2)n1 |
| InChI | InChI=1S/C13H21NO3S/c1-15-11(16-2)10-9-18-12(14-10)13(17-3)7-5-4-6-8-13/h9,11H,4-8H2,1-3H3 |
| InChIKey | UWVYTBYETWBQLO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|