C17H27ClN2O — CID 116745713
4-tert-butyl-6-chloro-2-[cyclohexyl(ethoxy)methyl]pyrimidine (PubChem CID 116745713) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 4-tert-butyl-6-chloro-2-[cyclohexyl(ethoxy)methyl]pyrimidine.
| Compound Name | 4-tert-butyl-6-chloro-2-[cyclohexyl(ethoxy)methyl]pyrimidine |
|---|---|
| PubChem CID | 116745713 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 4-tert-butyl-6-chloro-2-[cyclohexyl(ethoxy)methyl]pyrimidine |
| SMILES | CCOC(c1nc(Cl)cc(C(C)(C)C)n1)C1CCCCC1 |
| InChI | InChI=1S/C17H27ClN2O/c1-5-21-15(12-9-7-6-8-10-12)16-19-13(17(2,3)4)11-14(18)20-16/h11-12,15H,5-10H2,1-4H3 |
| InChIKey | LRHWABCFAGZCFS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |