C16H23BrO3 — CID 116753002
2-(2-bromo-5-methoxyphenyl)-1-(1-ethoxycyclopentyl)ethanol (PubChem CID 116753002) has the molecular formula C16H23BrO3 and a molecular weight of 343.26 g/mol. Its IUPAC name is 2-(2-bromo-5-methoxyphenyl)-1-(1-ethoxycyclopentyl)ethanol.
| Compound Name | 2-(2-bromo-5-methoxyphenyl)-1-(1-ethoxycyclopentyl)ethanol |
|---|---|
| PubChem CID | 116753002 |
| Molecular Formula | C16H23BrO3 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-(2-bromo-5-methoxyphenyl)-1-(1-ethoxycyclopentyl)ethanol |
| SMILES | CCOC1(C(O)Cc2cc(OC)ccc2Br)CCCC1 |
| InChI | InChI=1S/C16H23BrO3/c1-3-20-16(8-4-5-9-16)15(18)11-12-10-13(19-2)6-7-14(12)17/h6-7,10,15,18H,3-5,8-9,11H2,1-2H3 |
| InChIKey | ZLWJFQXYHKPFFB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |