C17H24ClFO2 — CID 116755178
2-(2-chloro-3-fluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanol (PubChem CID 116755178) has the molecular formula C17H24ClFO2 and a molecular weight of 314.83 g/mol. Its IUPAC name is 2-(2-chloro-3-fluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanol.
| Compound Name | 2-(2-chloro-3-fluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanol |
|---|---|
| PubChem CID | 116755178 |
| Molecular Formula | C17H24ClFO2 |
| Molecular Weight | 314.83 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 2-(2-chloro-3-fluorophenyl)-1-(1-ethoxy-3-methylcyclohexyl)ethanol |
| SMILES | CCOC1(C(O)Cc2cccc(F)c2Cl)CCCC(C)C1 |
| InChI | InChI=1S/C17H24ClFO2/c1-3-21-17(9-5-6-12(2)11-17)15(20)10-13-7-4-8-14(19)16(13)18/h4,7-8,12,15,20H,3,5-6,9-11H2,1-2H3 |
| InChIKey | BMOUFRLBLKYGRU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.83 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |