C16H23ClO2 — CID 116755230
(4-chlorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanol (PubChem CID 116755230) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is (4-chlorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanol.
| Compound Name | (4-chlorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 116755230 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (4-chlorophenyl)-(1-ethoxy-3-methylcyclohexyl)methanol |
| SMILES | CCOC1(C(O)c2ccc(Cl)cc2)CCCC(C)C1 |
| InChI | InChI=1S/C16H23ClO2/c1-3-19-16(10-4-5-12(2)11-16)15(18)13-6-8-14(17)9-7-13/h6-9,12,15,18H,3-5,10-11H2,1-2H3 |
| InChIKey | IVBGTAGSXFIZQX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |