C13H24O2 — CID 116755683
cyclopropyl-(1-methoxy-4,4-dimethylcyclohexyl)methanol (PubChem CID 116755683) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is cyclopropyl-(1-methoxy-4,4-dimethylcyclohexyl)methanol.
| Compound Name | cyclopropyl-(1-methoxy-4,4-dimethylcyclohexyl)methanol |
|---|---|
| PubChem CID | 116755683 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | cyclopropyl-(1-methoxy-4,4-dimethylcyclohexyl)methanol |
| SMILES | COC1(C(O)C2CC2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H24O2/c1-12(2)6-8-13(15-3,9-7-12)11(14)10-4-5-10/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | NPJOKSWVVXIJCZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |