C16H32O2 — CID 116755710
1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol (PubChem CID 116755710) has the molecular formula C16H32O2 and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol.
| Compound Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol |
|---|---|
| PubChem CID | 116755710 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol |
| SMILES | CCCC(C)CC(O)C1(OC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H32O2/c1-6-7-13(2)12-14(17)16(18-5)10-8-15(3,4)9-11-16/h13-14,17H,6-12H2,1-5H3 |
| InChIKey | PMLJDMJBMKMGQF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |