About 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol
1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol (PubChem CID 116755710) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol.
Molecular Properties
| Compound Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol |
| PubChem CID | 116755710 |
| Molecular Formula | C16H32O2 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.24 |
| IUPAC Name | 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol |
| SMILES | CCCC(C)CC(O)C1(OC)CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H32O2/c1-6-7-13(2)12-14(17)16(18-5)10-8-15(3,4)9-11-16/h13-14,17H,6-12H2,1-5H3 |
| InChIKey | PMLJDMJBMKMGQF-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol?
The IUPAC name of 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol (CID 116755710) is 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol.
What is the SMILES notation for 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol?
The canonical SMILES for 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol is CCCC(C)CC(O)C1(OC)CCC(C)(C)CC1.
What is the InChIKey of 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol?
The InChIKey is PMLJDMJBMKMGQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-6-7-13(2)12-14(17)16(18-5)10-8-15(3,4)9-11-16/h13-14,17H,6-12H2,1-5H3.
What are the key properties of 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol?
1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol has a molecular weight of 256.43 g/mol, XLogP of 4.16, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxy-4,4-dimethylcyclohexyl)-3-methylhexan-1-ol is sourced from PubChem (CID 116755710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).