C12H27NO3S — CID 116758182
4-methoxy-4-methyl-1-methylsulfonyl-N-propylhexan-3-amine (PubChem CID 116758182) has the molecular formula C12H27NO3S and a molecular weight of 265.42 g/mol. Its IUPAC name is 4-methoxy-4-methyl-1-methylsulfonyl-N-propylhexan-3-amine.
| Compound Name | 4-methoxy-4-methyl-1-methylsulfonyl-N-propylhexan-3-amine |
|---|---|
| PubChem CID | 116758182 |
| Molecular Formula | C12H27NO3S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | 4-methoxy-4-methyl-1-methylsulfonyl-N-propylhexan-3-amine |
| SMILES | CCCNC(CCS(C)(=O)=O)C(C)(CC)OC |
| InChI | InChI=1S/C12H27NO3S/c1-6-9-13-11(8-10-17(5,14)15)12(3,7-2)16-4/h11,13H,6-10H2,1-5H3 |
| InChIKey | HHVHIDBDYJPMGO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |