C11H25NO3S — CID 116757678
5-methoxy-N,5-dimethyl-1-methylsulfonylheptan-4-amine (PubChem CID 116757678) has the molecular formula C11H25NO3S and a molecular weight of 251.39 g/mol. Its IUPAC name is 5-methoxy-N,5-dimethyl-1-methylsulfonylheptan-4-amine.
| Compound Name | 5-methoxy-N,5-dimethyl-1-methylsulfonylheptan-4-amine |
|---|---|
| PubChem CID | 116757678 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 5-methoxy-N,5-dimethyl-1-methylsulfonylheptan-4-amine |
| SMILES | CCC(C)(OC)C(CCCS(C)(=O)=O)NC |
| InChI | InChI=1S/C11H25NO3S/c1-6-11(2,15-4)10(12-3)8-7-9-16(5,13)14/h10,12H,6-9H2,1-5H3 |
| InChIKey | ZGYHARZGNRITDN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |