C6H13F3N2O2S — CID 105215617
(1,1,1-trifluoro-5-methylsulfonylpentan-2-yl)hydrazine (PubChem CID 105215617) has the molecular formula C6H13F3N2O2S and a molecular weight of 234.24 g/mol. Its IUPAC name is (1,1,1-trifluoro-5-methylsulfonylpentan-2-yl)hydrazine.
| Compound Name | (1,1,1-trifluoro-5-methylsulfonylpentan-2-yl)hydrazine |
|---|---|
| PubChem CID | 105215617 |
| Molecular Formula | C6H13F3N2O2S |
| Molecular Weight | 234.24 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (1,1,1-trifluoro-5-methylsulfonylpentan-2-yl)hydrazine |
| SMILES | CS(=O)(=O)CCCC(NN)C(F)(F)F |
| InChI | InChI=1S/C6H13F3N2O2S/c1-14(12,13)4-2-3-5(11-10)6(7,8)9/h5,11H,2-4,10H2,1H3 |
| InChIKey | LILLMRXGZCNXHS-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|