C9H18F3NO2S — CID 63192586
N-ethyl-1,1,1-trifluoro-6-methylsulfonylhexan-3-amine (PubChem CID 63192586) has the molecular formula C9H18F3NO2S and a molecular weight of 261.31 g/mol. Its IUPAC name is N-ethyl-1,1,1-trifluoro-6-methylsulfonylhexan-3-amine.
| Compound Name | N-ethyl-1,1,1-trifluoro-6-methylsulfonylhexan-3-amine |
|---|---|
| PubChem CID | 63192586 |
| Molecular Formula | C9H18F3NO2S |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | N-ethyl-1,1,1-trifluoro-6-methylsulfonylhexan-3-amine |
| SMILES | CCNC(CCCS(C)(=O)=O)CC(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2S/c1-3-13-8(7-9(10,11)12)5-4-6-16(2,14)15/h8,13H,3-7H2,1-2H3 |
| InChIKey | PQJCEFFRDUAHNZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |