C11H27N3O2S — CID 105243995
N,N-diethyl-3-hydrazinyl-6-methylsulfonylhexan-1-amine (PubChem CID 105243995) has the molecular formula C11H27N3O2S and a molecular weight of 265.42 g/mol. Its IUPAC name is N,N-diethyl-3-hydrazinyl-6-methylsulfonylhexan-1-amine.
| Compound Name | N,N-diethyl-3-hydrazinyl-6-methylsulfonylhexan-1-amine |
|---|---|
| PubChem CID | 105243995 |
| Molecular Formula | C11H27N3O2S |
| Molecular Weight | 265.42 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N,N-diethyl-3-hydrazinyl-6-methylsulfonylhexan-1-amine |
| SMILES | CCN(CC)CCC(CCCS(C)(=O)=O)NN |
| InChI | InChI=1S/C11H27N3O2S/c1-4-14(5-2)9-8-11(13-12)7-6-10-17(3,15)16/h11,13H,4-10,12H2,1-3H3 |
| InChIKey | USMZFXSEJGMMEY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.42 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|