C12H28N2O2S — CID 79086946
1-N,1-N,3-N-triethyl-5-methylsulfonylpentane-1,3-diamine (PubChem CID 79086946) has the molecular formula C12H28N2O2S and a molecular weight of 264.43 g/mol. Its IUPAC name is 1-N,1-N,3-N-triethyl-5-methylsulfonylpentane-1,3-diamine.
| Compound Name | 1-N,1-N,3-N-triethyl-5-methylsulfonylpentane-1,3-diamine |
|---|---|
| PubChem CID | 79086946 |
| Molecular Formula | C12H28N2O2S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 1-N,1-N,3-N-triethyl-5-methylsulfonylpentane-1,3-diamine |
| SMILES | CCNC(CCN(CC)CC)CCS(C)(=O)=O |
| InChI | InChI=1S/C12H28N2O2S/c1-5-13-12(9-11-17(4,15)16)8-10-14(6-2)7-3/h12-13H,5-11H2,1-4H3 |
| InChIKey | JSZLKWUSNFOCNB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |