C18H32N2 — CID 79086954
1-N,1-N,3-N-triethyl-6-phenylhexane-1,3-diamine (PubChem CID 79086954) has the molecular formula C18H32N2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 1-N,1-N,3-N-triethyl-6-phenylhexane-1,3-diamine.
| Compound Name | 1-N,1-N,3-N-triethyl-6-phenylhexane-1,3-diamine |
|---|---|
| PubChem CID | 79086954 |
| Molecular Formula | C18H32N2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.26 |
| IUPAC Name | 1-N,1-N,3-N-triethyl-6-phenylhexane-1,3-diamine |
| SMILES | CCNC(CCCc1ccccc1)CCN(CC)CC |
| InChI | InChI=1S/C18H32N2/c1-4-19-18(15-16-20(5-2)6-3)14-10-13-17-11-8-7-9-12-17/h7-9,11-12,18-19H,4-6,10,13-16H2,1-3H3 |
| InChIKey | LODFFACNNWRFIN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |