C19H24BrN — CID 63412898
1-(4-bromophenyl)-N-ethyl-5-phenylpentan-2-amine (PubChem CID 63412898) has the molecular formula C19H24BrN and a molecular weight of 346.31 g/mol. Its IUPAC name is 1-(4-bromophenyl)-N-ethyl-5-phenylpentan-2-amine.
| Compound Name | 1-(4-bromophenyl)-N-ethyl-5-phenylpentan-2-amine |
|---|---|
| PubChem CID | 63412898 |
| Molecular Formula | C19H24BrN |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(4-bromophenyl)-N-ethyl-5-phenylpentan-2-amine |
| SMILES | CCNC(CCCc1ccccc1)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H24BrN/c1-2-21-19(15-17-11-13-18(20)14-12-17)10-6-9-16-7-4-3-5-8-16/h3-5,7-8,11-14,19,21H,2,6,9-10,15H2,1H3 |
| InChIKey | OXSDQKKVPGZZBO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |